cas: 1638765-30-6 — see every product listed under this CAS number, including other names
Bicyclo[1.1.1]pentane-1,3-dicarboxylic acid, 1-(1,1-dimethylethyl) ester, 97%, 97% (CAS 1638765-30-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYZT-100g |
| cas | 1638765-30-6 |
| size | 100g |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 14656.40 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1451.60 Pln | |
| Chemat | 10g | 2555.60 Pln | |
| Chemat | 25g | 5229.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[(2-methylpropan-2-yl)oxycarbonyl]bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 1638765-30-6) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonyl]bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: GWMJQGGVPOMUAO-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonyl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | GWMJQGGVPOMUAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C12CC(C1)(C2)C(=O)O |
Computed by PubChem (NCBI)