cas: 306936-65-2 — see every product listed under this CAS number, including other names
3-[4-(TRIFLUOROMETHYL)PHENYL]-1H-PYRAZOLE-4-CARBALDEHYDE, 95% (CAS 306936-65-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386918-100MG |
| cas | 306936-65-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 622.72 Pln | |
| Fluorochem | 250mg | 1065.27 Pln | |
| Fluorochem | 500mg | 1637.98 Pln | |
| Fluorochem | 1g | 2549.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-[4-(trifluoromethyl)phenyl]-1H-pyrazole-4-carbaldehyde (CAS 306936-65-2) is a chemical compound with the molecular formula C11H7F3N2O and a molecular weight of 240.18 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]-1H-pyrazole-4-carbaldehyde. InChIKey: PMKPJAJMBQBTKE-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | 5-[4-(trifluoromethyl)phenyl]-1H-pyrazole-4-carbaldehyde |
| InChIKey | PMKPJAJMBQBTKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NN2)C=O)C(F)(F)F |
Computed by PubChem (NCBI)