Products 1393125-27-3
CAS 1393125-27-3 is the registry number for 4-[4-(Trifluoromethyl)-1h-pyrazol-1-yl]benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[4-(trifluoromethyl)pyrazol-1-yl]benzaldehyde (CAS 1393125-27-3) is a chemical compound with the molecular formula C11H7F3N2O and a molecular weight of 240.18 g/mol. IUPAC name: 4-[4-(trifluoromethyl)pyrazol-1-yl]benzaldehyde. InChIKey: XNIOOCZQLOFSJS-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)pyrazol-1-yl]benzaldehyde |
| InChIKey | XNIOOCZQLOFSJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)N2C=C(C=N2)C(F)(F)F |
Computed by PubChem (NCBI)