CAS 67804-93-7 appears in our catalog under these names: 4-Phenyl-6-(trifluoromethyl)pyrimidin-2-ol, 95%, 4-Phenyl-6-(trifluoromethyl)pyrimidin-2-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-phenyl-6-(trifluoromethyl)-1H-pyrimidin-2-one (CAS 67804-93-7) is a chemical compound with the molecular formula C11H7F3N2O and a molecular weight of 240.18 g/mol. IUPAC name: 4-phenyl-6-(trifluoromethyl)-1H-pyrimidin-2-one. InChIKey: XQQSFWKOCNZPPF-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | 4-phenyl-6-(trifluoromethyl)-1H-pyrimidin-2-one |
| InChIKey | XQQSFWKOCNZPPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=O)NC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)