cas: 1073182-86-1 — see every product listed under this CAS number, including other names
3-AMino-4,6-dichloro-2-pyridinecarbonitrile, 97%, 97% (CAS 1073182-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1109IS-100mg |
| cas | 1073182-86-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 2843.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-amino-4,6-dichloropyridine-2-carbonitrile (CAS 1073182-86-1) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 3-amino-4,6-dichloropyridine-2-carbonitrile. InChIKey: BLGLXCSAPQHZFU-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 3-amino-4,6-dichloropyridine-2-carbonitrile |
| InChIKey | BLGLXCSAPQHZFU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)C#N)N)Cl |
Computed by PubChem (NCBI)