3-Acetamidophenylboronic acid 95%
cas: 78887-39-5 — see every product listed under this CAS number, including other names
3-Acetamidophenylboronic acid 95% (CAS 78887-39-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A171990-250mg |
| cas | 78887-39-5 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 242.44 Pln | |
| Ambeed | 25g | 487.19 Pln | |
| Ambeed | 100g | 1638.62 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A171990 |
(3-acetamidophenyl)boronic acid (CAS 78887-39-5) is a chemical compound with the molecular formula C8H10BNO3 and a molecular weight of 178.98 g/mol. IUPAC name: (3-acetamidophenyl)boronic acid. InChIKey: IBTSWKLSEOGJGJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO3 |
|---|---|
| Molecular weight | 178.98 g/mol |
| IUPAC name | (3-acetamidophenyl)boronic acid |
| InChIKey | IBTSWKLSEOGJGJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-acetamidophenyl)boronic acid, 3-Acetamidophenylboronic acid, 3-Acetylaminophenylboronic acid, 3-Acetamidobenzeneboronic acid, (3-acetylaminophenyl)boronic acid, 3-Acetamidophenylboronicacid, 3-(acetylamino)phenylboronic acid, Boronic acid, (3-(acetylamino)phenyl)-, Boronic acid, [3-(acetylamino)phenyl]-, 3-(acetylamino) phenylboronic acid