CAS 78887-39-5 appears in our catalog under these names: 3-Acetylaminophenylboronic acid, 97%, 3–Acetamidophenylboronic Acid (contains varying amounts of Anhydride), 3-Acetamidophenylboronic acid/ 95+%, 3-Acetamidobenzeneboronic acid, 98% , 3-Acetamidophenylboronic Acid (contains varying amounts of Anhydride). Offered by: Combi-blocks, GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 5g, 25g, 100g, 1g, 250mg, 10g, 500g.
(3-acetamidophenyl)boronic acid (CAS 78887-39-5) is a chemical compound with the molecular formula C8H10BNO3 and a molecular weight of 178.98 g/mol. IUPAC name: (3-acetamidophenyl)boronic acid. InChIKey: IBTSWKLSEOGJGJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO3 |
|---|---|
| Molecular weight | 178.98 g/mol |
| IUPAC name | (3-acetamidophenyl)boronic acid |
| InChIKey | IBTSWKLSEOGJGJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)C)(O)O |
Computed by PubChem (NCBI)