cas: 78887-39-5 — see every product listed under this CAS number, including other names
3-Acetamidophenylboronic Acid (contains varying amounts of Anhydride) (CAS 78887-39-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2453-1G |
| cas | 78887-39-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 300.28 Pln | |
| TCI | 5g | 1421.42 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
(3-acetamidophenyl)boronic acid (CAS 78887-39-5) is a chemical compound with the molecular formula C8H10BNO3 and a molecular weight of 178.98 g/mol. IUPAC name: (3-acetamidophenyl)boronic acid. InChIKey: IBTSWKLSEOGJGJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO3 |
|---|---|
| Molecular weight | 178.98 g/mol |
| IUPAC name | (3-acetamidophenyl)boronic acid |
| InChIKey | IBTSWKLSEOGJGJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)C)(O)O |
Computed by PubChem (NCBI)