cas: 711002-74-3 — see every product listed under this CAS number, including other names
3-Amino-1-N-Cbz-piperidine 97% (CAS 711002-74-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 250mg, 1g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A228575-5g |
| cas | 711002-74-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 826.50 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 10g | 381.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A228575 |
Benzyl 3-aminopiperidine-1-carboxylate (CAS 711002-74-3) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl 3-aminopiperidine-1-carboxylate. InChIKey: PBFBPDLWODIXHK-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl 3-aminopiperidine-1-carboxylate |
| InChIKey | PBFBPDLWODIXHK-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)