cas: 711002-74-3 — see every product listed under this CAS number, including other names
3-Amino-1-N-Cbz-piperidine, 96% (CAS 711002-74-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034368-250MG |
| cas | 711002-74-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 893.45 Pln | |
| Fluorochem | 100g | 2939.61 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 3-aminopiperidine-1-carboxylate (CAS 711002-74-3) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl 3-aminopiperidine-1-carboxylate. InChIKey: PBFBPDLWODIXHK-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl 3-aminopiperidine-1-carboxylate |
| InChIKey | PBFBPDLWODIXHK-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)