CAS 876461-55-1 appears in our catalog under these names: (S)-Benzyl 3-aminopiperidine-1-carboxylate, 97%, 1-Piperidinecarboxylic acid, 3-amino-, phenylmethyl ester, (3S)-, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
Benzyl (3S)-3-aminopiperidine-1-carboxylate (CAS 876461-55-1) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl (3S)-3-aminopiperidine-1-carboxylate. InChIKey: PBFBPDLWODIXHK-LBPRGKRZSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl (3S)-3-aminopiperidine-1-carboxylate |
| InChIKey | PBFBPDLWODIXHK-LBPRGKRZSA-N |
| SMILES | C1C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)