cas: 1369948-83-3 — see every product listed under this CAS number, including other names
3-Amino-2-fluorobenzamide 95% (CAS 1369948-83-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156970-100mg |
| cas | 1369948-83-3 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 609.56 Pln | |
| Ambeed | 10g | 1121.31 Pln | |
| Ambeed | 25g | 1610.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A156970 |
3-amino-2-fluorobenzamide (CAS 1369948-83-3) is a chemical compound with the molecular formula C7H7FN2O and a molecular weight of 154.14 g/mol. IUPAC name: 3-amino-2-fluorobenzamide. InChIKey: ILKBRROLHNYTQT-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O |
|---|---|
| Molecular weight | 154.14 g/mol |
| IUPAC name | 3-amino-2-fluorobenzamide |
| InChIKey | ILKBRROLHNYTQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)F)C(=O)N |
Computed by PubChem (NCBI)