cas: 58327-76-7 — see every product listed under this CAS number, including other names
3-Amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid, 95%, 95% (CAS 58327-76-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ECNL-100mg |
| cas | 58327-76-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid (CAS 58327-76-7) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid. InChIKey: DHDJIMYHPMEMTR-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | DHDJIMYHPMEMTR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=C(S2)C(=O)O)N)C |
Computed by PubChem (NCBI)