CAS 1623083-99-7 appears in our catalog under these names: 5-Ethyl-2-(1h-pyrrol-1-yl)-1,3-thiazole-4-carboxylic acid, 95%, 5-Ethyl-2-(1H-pyrrol-1-yl)-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg.
5-ethyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid (CAS 1623083-99-7) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: 5-ethyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid. InChIKey: FMPJZDRJRIYWKP-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 5-ethyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | FMPJZDRJRIYWKP-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(S1)N2C=CC=C2)C(=O)O |
Computed by PubChem (NCBI)