Products 104344-75-4
CAS 104344-75-4 appears in our catalog under these names: 3-(Benzothiazol-2-ylamino)-propionic acid, 95%, 3-(Benzo(d)thiazol-2-ylamino)propanoic acid, 97%, 3-(Benzothiazol-2-ylamino)-propionic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(1,3-benzothiazol-2-ylamino)propanoic acid (CAS 104344-75-4) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-ylamino)propanoic acid. InChIKey: XIDIZOFBBGMQTL-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 3-(1,3-benzothiazol-2-ylamino)propanoic acid |
| InChIKey | XIDIZOFBBGMQTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(Benzothiazol-2-ylamino)-propionic acid, 3-(1,3-benzothiazol-2-ylamino)propanoic acid, 3-(Benzo[d]thiazol-2-ylamino)propanoic acid, 3-[(1,3-benzothiazol-2-yl)amino]propanoic acid, 3-(benzothiazol-2-ylamino)propanoic acid, TimTec1_008472, Oprea1_324094, Oprea1_761575, 3-(Benzo[d]thiazol-2-ylamino)propanoicacid