cas: 329210-07-3 — see every product listed under this CAS number, including other names
3-Amino-5-chloro-benzofuran-2-carboxylic acid ethyl ester (CAS 329210-07-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F015475-1G |
| cas | 329210-07-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1299.56 Pln | |
| Fluorochem | 5g | 3829.92 Pln |
| delivery time | 2-3 weeks |
|---|
Ethyl 3-amino-5-chloro-1-benzofuran-2-carboxylate (CAS 329210-07-3) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: ethyl 3-amino-5-chloro-1-benzofuran-2-carboxylate. InChIKey: VKKDUUXDTANQAJ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | ethyl 3-amino-5-chloro-1-benzofuran-2-carboxylate |
| InChIKey | VKKDUUXDTANQAJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(O1)C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)