CAS 329210-07-3 appears in our catalog under these names: Ethyl 3-amino-5-chlorobenzofuran-2-carboxylate, 95%, 3-Amino-5-chloro-benzofuran-2-carboxylic acid ethyl ester, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
Ethyl 3-amino-5-chloro-1-benzofuran-2-carboxylate (CAS 329210-07-3) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: ethyl 3-amino-5-chloro-1-benzofuran-2-carboxylate. InChIKey: VKKDUUXDTANQAJ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | ethyl 3-amino-5-chloro-1-benzofuran-2-carboxylate |
| InChIKey | VKKDUUXDTANQAJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(O1)C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)