CAS 869464-85-7 appears in our catalog under these names: 4-Chloro-2-(2-oxopyrrolidin-1-yl)benzoic acid, 95%, 4-Chloro-2-(2-oxopyrrolidin-1-yl)benzoic acid, 4-Chloro-2-(2-oxopyrrolidin-1-yl)benzoic acid 95%, 4-Chloro-2-(2-oxopyrrolidin-1-yl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
4-chloro-2-(2-oxopyrrolidin-1-yl)benzoic acid (CAS 869464-85-7) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 4-chloro-2-(2-oxopyrrolidin-1-yl)benzoic acid. InChIKey: ZHYKUDYDCHFXRN-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 4-chloro-2-(2-oxopyrrolidin-1-yl)benzoic acid |
| InChIKey | ZHYKUDYDCHFXRN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)