cas: 351422-73-6 — see every product listed under this CAS number, including other names
3-Aminocarbonylphenylboronic acid, 95% (CAS 351422-73-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 20g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036708-1G |
| cas | 351422-73-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 20g | 237.43 Pln | |
| Fluorochem | 25g | 268.67 Pln | |
| Fluorochem | 100g | 872.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(3-carbamoylphenyl)boronic acid (CAS 351422-73-6) is a chemical compound with the molecular formula C7H8BNO3 and a molecular weight of 164.96 g/mol. IUPAC name: (3-carbamoylphenyl)boronic acid. InChIKey: WDGWHKRJEBENCE-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO3 |
|---|---|
| Molecular weight | 164.96 g/mol |
| IUPAC name | (3-carbamoylphenyl)boronic acid |
| InChIKey | WDGWHKRJEBENCE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N)(O)O |
Computed by PubChem (NCBI)