CAS 179942-51-9 appears in our catalog under these names: 4-(Hydroxyimino)methylphenylboronic acid, 98%, 4–(Hydroxyimino)methylphenylboronic acid, (4-((Hydroxyimino)methyl)phenyl)boronic acid 95%, (4-((Hydroxyimino)methyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
[4-[(E)-hydroxyiminomethyl]phenyl]boronic acid (CAS 179942-51-9) is a chemical compound with the molecular formula C7H8BNO3 and a molecular weight of 164.96 g/mol. IUPAC name: [4-[(E)-hydroxyiminomethyl]phenyl]boronic acid. InChIKey: BHSGANPJSINVBL-WEVVVXLNSA-N.
| Molecular formula | C7H8BNO3 |
|---|---|
| Molecular weight | 164.96 g/mol |
| IUPAC name | [4-[(E)-hydroxyiminomethyl]phenyl]boronic acid |
| InChIKey | BHSGANPJSINVBL-WEVVVXLNSA-N |
| SMILES | B(C1=CC=C(C=C1)/C=N/O)(O)O |
Computed by PubChem (NCBI)