CAS 938443-32-4 appears in our catalog under these names: 3-(Hydroxyimino)methylphenylboronic acid, 95%, (3–((E)–hydroxyiminomethyl)phenyl)boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 25g, 10g, 100g, 5g.
[3-[(E)-hydroxyiminomethyl]phenyl]boronic acid (CAS 938443-32-4) is a chemical compound with the molecular formula C7H8BNO3 and a molecular weight of 164.96 g/mol. IUPAC name: [3-[(E)-hydroxyiminomethyl]phenyl]boronic acid. InChIKey: MAJVYIIPEHMBDV-WEVVVXLNSA-N.
| Molecular formula | C7H8BNO3 |
|---|---|
| Molecular weight | 164.96 g/mol |
| IUPAC name | [3-[(E)-hydroxyiminomethyl]phenyl]boronic acid |
| InChIKey | MAJVYIIPEHMBDV-WEVVVXLNSA-N |
| SMILES | B(C1=CC(=CC=C1)/C=N/O)(O)O |
Computed by PubChem (NCBI)