cas: 1021910-58-6 — see every product listed under this CAS number, including other names
3-BROMO-2-(2,5-DIMETHYL-1H-PYRROL-1-YL)PYRIDINE, 98% (CAS 1021910-58-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472086-100MG |
| cas | 1021910-58-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 1049.65 Pln | |
| Fluorochem | 1g | 2736.55 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-2-(2,5-dimethylpyrrol-1-yl)pyridine (CAS 1021910-58-6) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 3-bromo-2-(2,5-dimethylpyrrol-1-yl)pyridine. InChIKey: SADHFLDUJLSDPH-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 3-bromo-2-(2,5-dimethylpyrrol-1-yl)pyridine |
| InChIKey | SADHFLDUJLSDPH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=C(C=CC=N2)Br)C |
Computed by PubChem (NCBI)