CAS 497261-38-8 appears in our catalog under these names: 8-Bromo-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indole, 95%, 8-Bromo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole 97%, 8-Bromo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole, 98%, 98%, 8-Bromo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
8-bromo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (CAS 497261-38-8) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 8-bromo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole. InChIKey: NCYAUUMFSRUGHL-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 8-bromo-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| InChIKey | NCYAUUMFSRUGHL-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)