Products 1713265-20-3
CAS 1713265-20-3 appears in our catalog under these names: 5-Bromo-n,n-dimethyl-8-quinolinamine, 95%, 8-Quinolinamine, 5-bromo-N,N-dimethyl-, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
5-bromo-N,N-dimethylquinolin-8-amine (CAS 1713265-20-3) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 5-bromo-N,N-dimethylquinolin-8-amine. InChIKey: HMUPTFCIKPLNCZ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 5-bromo-N,N-dimethylquinolin-8-amine |
| InChIKey | HMUPTFCIKPLNCZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C2C(=C(C=C1)Br)C=CC=N2 |
Computed by PubChem (NCBI)