cas: 1935930-11-2 — see every product listed under this CAS number, including other names
3-BROMO-5-CHLORO-1H-PYRAZOLO[4,3-D]PYRIMIDINE, 97% (CAS 1935930-11-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F847915-100MG |
| cas | 1935930-11-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 1158.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-5-chloro-2H-pyrazolo[4,3-d]pyrimidine (CAS 1935930-11-2) is a chemical compound with the molecular formula C5H2BrClN4 and a molecular weight of 233.45 g/mol. IUPAC name: 3-bromo-5-chloro-2H-pyrazolo[4,3-d]pyrimidine. InChIKey: XCRIHEKACCATGR-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN4 |
|---|---|
| Molecular weight | 233.45 g/mol |
| IUPAC name | 3-bromo-5-chloro-2H-pyrazolo[4,3-d]pyrimidine |
| InChIKey | XCRIHEKACCATGR-UHFFFAOYSA-N |
| SMILES | C1=NC(=NC2=C(NN=C21)Br)Cl |
Computed by PubChem (NCBI)