CAS 1235374-46-5 appears in our catalog under these names: 7-Bromo-4-chloroimidazo[2,1-f][1,2,4]triazine, 95%, 7-Bromo-4-chloroimidazo(2,1-f)(1,2,4)triazine, 97%, 7-Bromo-4-chloroimidazo[2,1-f][1,2,4]triazine, 97%, 97%, 7-BROMO-4-CHLOROIMIDAZO[2,1-F][1,2,4]TRIAZINE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg, 500mg.
7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine (CAS 1235374-46-5) is a chemical compound with the molecular formula C5H2BrClN4 and a molecular weight of 233.45 g/mol. IUPAC name: 7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine. InChIKey: RRXLWAFFBIFFKO-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN4 |
|---|---|
| Molecular weight | 233.45 g/mol |
| IUPAC name | 7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine |
| InChIKey | RRXLWAFFBIFFKO-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=N1)C(=NC=N2)Cl)Br |
Computed by PubChem (NCBI)