CAS 1936016-69-1 appears in our catalog under these names: 2-Bromo-8-chloro-[1,2,4]triazolo[1,5-a]pyrazine, 95%, 2-Bromo-8-chloro-[1,2,4]triazolo[1,5-a]pyrazine, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-bromo-8-chloro-[1,2,4]triazolo[1,5-a]pyrazine (CAS 1936016-69-1) is a chemical compound with the molecular formula C5H2BrClN4 and a molecular weight of 233.45 g/mol. IUPAC name: 2-bromo-8-chloro-[1,2,4]triazolo[1,5-a]pyrazine. InChIKey: DKZPZRXERKEHRF-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN4 |
|---|---|
| Molecular weight | 233.45 g/mol |
| IUPAC name | 2-bromo-8-chloro-[1,2,4]triazolo[1,5-a]pyrazine |
| InChIKey | DKZPZRXERKEHRF-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)Br)C(=N1)Cl |
Computed by PubChem (NCBI)