cas: 1315360-86-1 — see every product listed under this CAS number, including other names
3-BROMO-7-CHLOROTHIENO[2,3-C]PYRIDINE, 97% (CAS 1315360-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F503425-100MG |
| cas | 1315360-86-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1700.46 Pln | |
| Fluorochem | 250mg | 2783.41 Pln | |
| Fluorochem | 500mg | 4590.07 Pln | |
| Fluorochem | 1g | 6839.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-7-chlorothieno[2,3-c]pyridine (CAS 1315360-86-1) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 3-bromo-7-chlorothieno[2,3-c]pyridine. InChIKey: SJCZRKWLMNKKIP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 3-bromo-7-chlorothieno[2,3-c]pyridine |
| InChIKey | SJCZRKWLMNKKIP-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1C(=CS2)Br)Cl |
Computed by PubChem (NCBI)