cas: 83507-33-9 — see every product listed under this CAS number, including other names
3-Benzyl-3-azabicyclo[3.2.1]octan-8-one 97% (CAS 83507-33-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A190701-250mg |
| cas | 83507-33-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 381.50 Pln | |
| Ambeed | 100g | 1154.69 Pln | |
| Ambeed | 500g | 4575.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A190701 |
3-benzyl-3-azabicyclo[3.2.1]octan-8-one (CAS 83507-33-9) is a chemical compound with the molecular formula C14H17NO and a molecular weight of 215.29 g/mol. IUPAC name: 3-benzyl-3-azabicyclo[3.2.1]octan-8-one. InChIKey: DCDAOVIVXGHHHU-UHFFFAOYSA-N.
| Molecular formula | C14H17NO |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 3-benzyl-3-azabicyclo[3.2.1]octan-8-one |
| InChIKey | DCDAOVIVXGHHHU-UHFFFAOYSA-N |
| SMILES | C1CC2CN(CC1C2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)