cas: 83507-33-9 — see every product listed under this CAS number, including other names
3-Benzyl-3-azabicyclo[3.2.1]octan-8-one, 97% (CAS 83507-33-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048276-1G |
| cas | 83507-33-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 100mg | 81.24 Pln | |
| Fluorochem | 250mg | 81.24 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 362.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-benzyl-3-azabicyclo[3.2.1]octan-8-one (CAS 83507-33-9) is a chemical compound with the molecular formula C14H17NO and a molecular weight of 215.29 g/mol. IUPAC name: 3-benzyl-3-azabicyclo[3.2.1]octan-8-one. InChIKey: DCDAOVIVXGHHHU-UHFFFAOYSA-N.
| Molecular formula | C14H17NO |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 3-benzyl-3-azabicyclo[3.2.1]octan-8-one |
| InChIKey | DCDAOVIVXGHHHU-UHFFFAOYSA-N |
| SMILES | C1CC2CN(CC1C2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)