3-Benzyl-3-azaspiro[bicyclo[3.2.1]octane-8,2'-[1,3]dioxolane], 98%
cas: 1019208-04-8 — see every product listed under this CAS number, including other names
3-Benzyl-3-azaspiro[bicyclo[3.2.1]octane-8,2'-[1,3]dioxolane], 98% (CAS 1019208-04-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A266518-250mg |
| cas | 1019208-04-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 526.12 Pln | |
| Ambeed | 10g | 971.12 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 371.60 Pln | |
| BLDpharm | 250mg | 131.09 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 558.72 Pln | |
| BLDpharm | 10g | 1041.88 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3'-benzylspiro[1,3-dioxolane-2,8'-3-azabicyclo[3.2.1]octane] (CAS 1019208-04-8) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 259.34 g/mol. IUPAC name: 3'-benzylspiro[1,3-dioxolane-2,8'-3-azabicyclo[3.2.1]octane]. InChIKey: JWYXZJIPWLIKSZ-UHFFFAOYSA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | 3'-benzylspiro[1,3-dioxolane-2,8'-3-azabicyclo[3.2.1]octane] |
| InChIKey | JWYXZJIPWLIKSZ-UHFFFAOYSA-N |
| SMILES | C1CC2CN(CC1C23OCCO3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
3-Benzyl-3-azaspiro[bicyclo[3.2.1]octane-8,2'-[1,3]dioxolane], 3'-benzylspiro[1,3-dioxolane-2,8'-3-azabicyclo[3.2.1]octane], Spiro[3-azabicyclo[3.2.1]octane-8,2'-[1,3]dioxolane], 3-(phenylmethyl)-, 3- Benzyl -3-spiro[bicyclo[3.2.1]cyclooctane-8,2'-[1,3]Dioxane, 3-Benzyl-3-azaspiro[bicyclo[3.2.1]octane-8,2''-[1,3]dioxolane], 3-Benzyl-3-azaspiro[bicyclo[3.2.1]octane-8,2'-[1,3]dioxolane, 3-Benzylspiro[3-azabicyclo[3.2.1]octane-8,2'-[1,3]dioxolane], 3-(Phenylmethyl)spiro[3-azabicyclo[3.2.1]octane-8,2'-[1,3]dioxolane], 3-(Phenylmethyl)spiro[3-azabicyclo[3.2.1]octane-8,2a(2)-[1,3]dioxolane]
![3- BENZYL -3-SPIRO[BICYCLO[3.2.1]CYCLOOCTANE-8,2'-[1,3]DIOXANE], 98%](https://cdn.chemat.com.pl/products/images/5a86b3ff8f816101a2e0adb57aa9d3f8406b57643058af771bcdb569d218821a.svg)