CAS 2173115-88-1 is the registry number for Ethyl 1,2,2,4-tetramethyl-1,2-dihydroquinoline-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 1,2,2,4-tetramethylquinoline-6-carboxylate (CAS 2173115-88-1) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 259.34 g/mol. IUPAC name: ethyl 1,2,2,4-tetramethylquinoline-6-carboxylate. InChIKey: GWVJMEHWYXQHCK-UHFFFAOYSA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | ethyl 1,2,2,4-tetramethylquinoline-6-carboxylate |
| InChIKey | GWVJMEHWYXQHCK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N(C(C=C2C)(C)C)C |
Computed by PubChem (NCBI)