Products 2059910-54-0

CAS 2059910-54-0 is the registry number for Trans-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (3S,4S)-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylate (CAS 2059910-54-0) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 259.34 g/mol. IUPAC name: methyl (3S,4S)-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylate. InChIKey: ZDMJGGAGLPQNCB-LSDHHAIUSA-N.

Identity
Molecular formulaC16H21NO2
Molecular weight259.34 g/mol
IUPAC namemethyl (3S,4S)-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylate
InChIKeyZDMJGGAGLPQNCB-LSDHHAIUSA-N
SMILESCOC(=O)[C@@H]1CN(C[C@H]1C2CC2)CC3=CC=CC=C3

Computed by PubChem (NCBI)