CAS 2059910-54-0 is the registry number for Trans-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl (3S,4S)-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylate (CAS 2059910-54-0) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 259.34 g/mol. IUPAC name: methyl (3S,4S)-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylate. InChIKey: ZDMJGGAGLPQNCB-LSDHHAIUSA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | methyl (3S,4S)-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylate |
| InChIKey | ZDMJGGAGLPQNCB-LSDHHAIUSA-N |
| SMILES | COC(=O)[C@@H]1CN(C[C@H]1C2CC2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)