cas: 1448312-00-2 — see every product listed under this CAS number, including other names
3-Borono-4-bromobenzoic acid (CAS 1448312-00-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691624-1G |
| cas | 1448312-00-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3824.71 Pln | |
| Fluorochem | 5g | 11327.28 Pln |
| delivery time | 3-4 weeks |
|---|
3-borono-4-bromobenzoic acid (CAS 1448312-00-2) is a chemical compound with the molecular formula C7H6BBrO4 and a molecular weight of 244.84 g/mol. IUPAC name: 3-borono-4-bromobenzoic acid. InChIKey: JUJQJPLPACWWKJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrO4 |
|---|---|
| Molecular weight | 244.84 g/mol |
| IUPAC name | 3-borono-4-bromobenzoic acid |
| InChIKey | JUJQJPLPACWWKJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)O)Br)(O)O |
Computed by PubChem (NCBI)