cas: 939759-25-8 — see every product listed under this CAS number, including other names
3-Bromo-1-azetidinecarboxylic acid benzyl ester, 95%, 95% (CAS 939759-25-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H281-100mg |
| cas | 939759-25-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 500mg | 621.20 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2603.60 Pln | |
| Chemat | 10g | 4077.20 Pln | |
| Chemat | 25g | 9808.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-bromoazetidine-1-carboxylate (CAS 939759-25-8) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: benzyl 3-bromoazetidine-1-carboxylate. InChIKey: SUBBMOROFINEHA-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | benzyl 3-bromoazetidine-1-carboxylate |
| InChIKey | SUBBMOROFINEHA-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)