cas: 325956-47-6 — see every product listed under this CAS number, including other names
3-Bromo-1-chloronaphthalene 97% (CAS 325956-47-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A263520-100mg |
| cas | 325956-47-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1382.75 Pln | |
| Ambeed | 10g | 2178.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A263520 |
3-bromo-1-chloronaphthalene (CAS 325956-47-6) is a chemical compound with the molecular formula C10H6BrCl and a molecular weight of 241.51 g/mol. IUPAC name: 3-bromo-1-chloronaphthalene. InChIKey: JVPDAEVSXKYYAS-UHFFFAOYSA-N.
| Molecular formula | C10H6BrCl |
|---|---|
| Molecular weight | 241.51 g/mol |
| IUPAC name | 3-bromo-1-chloronaphthalene |
| InChIKey | JVPDAEVSXKYYAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2Cl)Br |
Computed by PubChem (NCBI)