CAS 1000391-24-1 appears in our catalog under these names: 6-Bromo-1-chloronaphthalene 97%, 6-Bromo-1-chloronaphthalene, 98%, 6-Bromo-1-chloronaphthalene, 98%, 98%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-1-chloronaphthalene (CAS 1000391-24-1) is a chemical compound with the molecular formula C10H6BrCl and a molecular weight of 241.51 g/mol. IUPAC name: 6-bromo-1-chloronaphthalene. InChIKey: KUQJGFGVAJMCNG-UHFFFAOYSA-N.
| Molecular formula | C10H6BrCl |
|---|---|
| Molecular weight | 241.51 g/mol |
| IUPAC name | 6-bromo-1-chloronaphthalene |
| InChIKey | KUQJGFGVAJMCNG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C(=C1)Cl |
Computed by PubChem (NCBI)