CAS 51671-06-8 appears in our catalog under these names: 1-Bromo-3-chloronaphthalene 97%, 1-Bromo-3- chloronaphthalene, 97%, 97%, 1-Bromo-3-chloronaphthalene, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
1-bromo-3-chloronaphthalene (CAS 51671-06-8) is a chemical compound with the molecular formula C10H6BrCl and a molecular weight of 241.51 g/mol. IUPAC name: 1-bromo-3-chloronaphthalene. InChIKey: ABGYAXSJIBNZSF-UHFFFAOYSA-N.
| Molecular formula | C10H6BrCl |
|---|---|
| Molecular weight | 241.51 g/mol |
| IUPAC name | 1-bromo-3-chloronaphthalene |
| InChIKey | ABGYAXSJIBNZSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2Br)Cl |
Computed by PubChem (NCBI)