cas: 16726-66-2 — see every product listed under this CAS number, including other names
3-Bromo-1-naphthoic acid, 97%, 97% (CAS 16726-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZ7A-100mg |
| cas | 16726-66-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 500mg | 482.00 Pln | |
| Chemat | 1g | 702.80 Pln | |
| Chemat | 5g | 2694.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromonaphthalene-1-carboxylic acid (CAS 16726-66-2) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 3-bromonaphthalene-1-carboxylic acid. InChIKey: SBGVNBGHCCLMRR-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 3-bromonaphthalene-1-carboxylic acid |
| InChIKey | SBGVNBGHCCLMRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2C(=O)O)Br |
Computed by PubChem (NCBI)