cas: 16726-66-2 — see every product listed under this CAS number, including other names
3-Bromo-1-naphthoic acid, 95% (CAS 16726-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222466-100MG |
| cas | 16726-66-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 3668.52 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-bromonaphthalene-1-carboxylic acid (CAS 16726-66-2) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 3-bromonaphthalene-1-carboxylic acid. InChIKey: SBGVNBGHCCLMRR-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 3-bromonaphthalene-1-carboxylic acid |
| InChIKey | SBGVNBGHCCLMRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2C(=O)O)Br |
Computed by PubChem (NCBI)