cas: 871125-92-7 — see every product listed under this CAS number, including other names
3-Bromo-2-(phenylmethoxy)phenylboronic acid (CAS 871125-92-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627288-1G |
| cas | 871125-92-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1382.86 Pln |
| delivery time | 3-4 weeks |
|---|
(3-bromo-2-phenylmethoxyphenyl)boronic acid (CAS 871125-92-7) is a chemical compound with the molecular formula C13H12BBrO3 and a molecular weight of 306.95 g/mol. IUPAC name: (3-bromo-2-phenylmethoxyphenyl)boronic acid. InChIKey: HHGJDZMESYKSBQ-UHFFFAOYSA-N.
| Molecular formula | C13H12BBrO3 |
|---|---|
| Molecular weight | 306.95 g/mol |
| IUPAC name | (3-bromo-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | HHGJDZMESYKSBQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Br)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)