CAS 1256355-21-1 appears in our catalog under these names: 3-(Benzyloxy)-5-bromophenylboronic acid, 95%, 3-(Benzyloxy)-5-bromophenylboronic acid, ≥95%, ≥95%, (3-(Benzyloxy)-5-bromophenyl)boronic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(3-bromo-5-phenylmethoxyphenyl)boronic acid (CAS 1256355-21-1) is a chemical compound with the molecular formula C13H12BBrO3 and a molecular weight of 306.95 g/mol. IUPAC name: (3-bromo-5-phenylmethoxyphenyl)boronic acid. InChIKey: UQDMDMCDCBLNPN-UHFFFAOYSA-N.
| Molecular formula | C13H12BBrO3 |
|---|---|
| Molecular weight | 306.95 g/mol |
| IUPAC name | (3-bromo-5-phenylmethoxyphenyl)boronic acid |
| InChIKey | UQDMDMCDCBLNPN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)