Products 871125-92-7

CAS 871125-92-7 appears in our catalog under these names: 3-Bromo-2-(phenylmethoxy)phenylboronic acid, 95%, (2-(Benzyloxy)-3-bromophenyl)boronic acid, 98%, 3-Bromo-2-(phenylmethoxy)phenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(3-bromo-2-phenylmethoxyphenyl)boronic acid (CAS 871125-92-7) is a chemical compound with the molecular formula C13H12BBrO3 and a molecular weight of 306.95 g/mol. IUPAC name: (3-bromo-2-phenylmethoxyphenyl)boronic acid. InChIKey: HHGJDZMESYKSBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12BBrO3
Molecular weight306.95 g/mol
IUPAC name(3-bromo-2-phenylmethoxyphenyl)boronic acid
InChIKeyHHGJDZMESYKSBQ-UHFFFAOYSA-N
SMILESB(C1=C(C(=CC=C1)Br)OCC2=CC=CC=C2)(O)O

Computed by PubChem (NCBI)