cas: 1086393-00-1 — see every product listed under this CAS number, including other names
3-Bromo-2-(trifluoromethoxy)pyridine, 97% (CAS 1086393-00-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F498478-50MG |
| cas | 1086393-00-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1476.58 Pln | |
| Fluorochem | 100mg | 2455.40 Pln | |
| Fluorochem | 250mg | 4355.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-2-(trifluoromethoxy)pyridine (CAS 1086393-00-1) is a chemical compound with the molecular formula C6H3BrF3NO and a molecular weight of 241.99 g/mol. IUPAC name: 3-bromo-2-(trifluoromethoxy)pyridine. InChIKey: PRYCOFLBUSTFMV-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3NO |
|---|---|
| Molecular weight | 241.99 g/mol |
| IUPAC name | 3-bromo-2-(trifluoromethoxy)pyridine |
| InChIKey | PRYCOFLBUSTFMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)