cas: 74447-73-7 — see every product listed under this CAS number, including other names
3-Bromo-4-methoxybiphenyl, 98%, 98% (CAS 74447-73-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J35-250mg |
| cas | 74447-73-7 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 100g | 1163.60 Pln | |
| Chemat | 50g | 750.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-methoxy-4-phenylbenzene (CAS 74447-73-7) is a chemical compound with the molecular formula C13H11BrO and a molecular weight of 263.13 g/mol. IUPAC name: 2-bromo-1-methoxy-4-phenylbenzene. InChIKey: QJGJVVIDRMVQMR-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 2-bromo-1-methoxy-4-phenylbenzene |
| InChIKey | QJGJVVIDRMVQMR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)