cas: 76041-73-1 — see every product listed under this CAS number, including other names
3-Bromo-5-(trifluoromethyl)pyridin-2-ol 98% (CAS 76041-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A219972-1g |
| cas | 76041-73-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 259.12 Pln | |
| Ambeed | 100g | 804.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A219972 |
3-bromo-5-(trifluoromethyl)-1H-pyridin-2-one (CAS 76041-73-1) is a chemical compound with the molecular formula C6H3BrF3NO and a molecular weight of 241.99 g/mol. IUPAC name: 3-bromo-5-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: UWHKLLYQUQPOQK-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3NO |
|---|---|
| Molecular weight | 241.99 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | UWHKLLYQUQPOQK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1C(F)(F)F)Br |
Computed by PubChem (NCBI)