cas: 1935930-11-2 — see every product listed under this CAS number, including other names
3-Bromo-5-chloro-1H-pyrazolo[4,3-d]pyrimidine 97% (CAS 1935930-11-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A717933-50mg |
| cas | 1935930-11-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 292.50 Pln | |
| Ambeed | 100mg | 420.44 Pln | |
| Ambeed | 250mg | 731.94 Pln | |
| Ambeed | 1g | 1788.81 Pln | |
| Ambeed | 5g | 5771.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A717933 |
3-bromo-5-chloro-2H-pyrazolo[4,3-d]pyrimidine (CAS 1935930-11-2) is a chemical compound with the molecular formula C5H2BrClN4 and a molecular weight of 233.45 g/mol. IUPAC name: 3-bromo-5-chloro-2H-pyrazolo[4,3-d]pyrimidine. InChIKey: XCRIHEKACCATGR-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN4 |
|---|---|
| Molecular weight | 233.45 g/mol |
| IUPAC name | 3-bromo-5-chloro-2H-pyrazolo[4,3-d]pyrimidine |
| InChIKey | XCRIHEKACCATGR-UHFFFAOYSA-N |
| SMILES | C1=NC(=NC2=C(NN=C21)Br)Cl |
Computed by PubChem (NCBI)