cas: 1226808-68-9 — see every product listed under this CAS number, including other names
3-Bromo-5-propoxybenzoic acid (CAS 1226808-68-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237278-1G |
| cas | 1226808-68-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 945.52 Pln | |
| Fluorochem | 5g | 2694.90 Pln |
| delivery time | 3-4 weeks |
|---|
3-bromo-5-propoxybenzoic acid (CAS 1226808-68-9) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 3-bromo-5-propoxybenzoic acid. InChIKey: OFSWAAVHABKEGJ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 3-bromo-5-propoxybenzoic acid |
| InChIKey | OFSWAAVHABKEGJ-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC(=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)