cas: 1211589-13-7 — see every product listed under this CAS number, including other names
3-Bromo-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one, 95%, 95% (CAS 1211589-13-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110HL5-100mg |
| cas | 1211589-13-7 |
| size | 100mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 918.80 Pln | |
| Chemat | 1g | 2142.80 Pln | |
| Chemat | 5g | 5646.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (CAS 1211589-13-7) is a chemical compound with the molecular formula C7H5BrN2O and a molecular weight of 213.03 g/mol. IUPAC name: 3-bromo-6,7-dihydropyrrolo[3,4-b]pyridin-5-one. InChIKey: OQBWNLYBVXMBDO-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 3-bromo-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| InChIKey | OQBWNLYBVXMBDO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=N2)Br)C(=O)N1 |
Computed by PubChem (NCBI)