cas: 1211589-13-7 — see every product listed under this CAS number, including other names
3-Bromo-6,7-dihydro-5h-pyrrolo[3,4-b]pyridin-5-one, 95% (CAS 1211589-13-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | HB-6967-1g |
| cas | 1211589-13-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 627.92 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 1g | 2564.74 Pln | |
| Fluorochem | 5g | 7162.08 Pln | |
| Fluorochem | 10g | 14274.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-bromo-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (CAS 1211589-13-7) is a chemical compound with the molecular formula C7H5BrN2O and a molecular weight of 213.03 g/mol. IUPAC name: 3-bromo-6,7-dihydropyrrolo[3,4-b]pyridin-5-one. InChIKey: OQBWNLYBVXMBDO-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 3-bromo-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| InChIKey | OQBWNLYBVXMBDO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=N2)Br)C(=O)N1 |
Computed by PubChem (NCBI)